C23H32N2O2 — CID 90702273
1-[2-(1,2-diphenylethylimino)-1,3-oxazolidin-3-yl]ethanone;ethane (PubChem CID 90702273) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[2-(1,2-diphenylethylimino)-1,3-oxazolidin-3-yl]ethanone;ethane.
| Compound Name | 1-[2-(1,2-diphenylethylimino)-1,3-oxazolidin-3-yl]ethanone;ethane |
|---|---|
| PubChem CID | 90702273 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[2-(1,2-diphenylethylimino)-1,3-oxazolidin-3-yl]ethanone;ethane |
| SMILES | CC.CC.CC(=O)N1CCO/C1=N\C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2.2C2H6/c1-15(22)21-12-13-23-19(21)20-18(17-10-6-3-7-11-17)14-16-8-4-2-5-9-16;2*1-2/h2-11,18H,12-14H2,1H3;2*1-2H3/b20-19-;; |
| InChIKey | UTYCDYVJMREQDE-YSRXXYTISA-N |
| XLogP | 5.26 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|