C16H21N5O2S — CID 90705805
[5-(ethanethioylamino)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid (PubChem CID 90705805) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is [5-(ethanethioylamino)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid.
| Compound Name | [5-(ethanethioylamino)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid |
|---|---|
| PubChem CID | 90705805 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [5-(ethanethioylamino)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid |
| SMILES | CC(=S)NCCCCC(NC(=O)O)c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H21N5O2S/c1-11(24)17-10-6-5-9-13(18-16(22)23)15-19-14(20-21-15)12-7-3-2-4-8-12/h2-4,7-8,13,18H,5-6,9-10H2,1H3,(H,17,24)(H,22,23)(H,19,20,21) |
| InChIKey | RBGNWIFXQGQCBG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|