C23H28N6O5 — CID 25106202
tert-butyl N-[4-[(2,4-dihydroxybenzoyl)amino]-4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)butyl]carbamate (PubChem CID 25106202) has the molecular formula C23H28N6O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is tert-butyl N-[4-[(2,4-dihydroxybenzoyl)amino]-4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2,4-dihydroxybenzoyl)amino]-4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)butyl]carbamate |
|---|---|
| PubChem CID | 25106202 |
| Molecular Formula | C23H28N6O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | tert-butyl N-[4-[(2,4-dihydroxybenzoyl)amino]-4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(NC(=O)c1ccc(O)cc1O)c1nc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C23H28N6O5/c1-23(2,3)34-22(33)25-10-4-5-17(26-21(32)16-7-6-15(30)13-18(16)31)20-27-19(28-29-20)14-8-11-24-12-9-14/h6-9,11-13,17,30-31H,4-5,10H2,1-3H3,(H,25,33)(H,26,32)(H,27,28,29) |
| InChIKey | BUCSYGHKQWQDOC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|