C20H18F2N2O4 — CID 90710946
[4-[2-(difluoromethyl)-4-(6-methoxy-3-pyridinyl)-1,3-oxazol-5-yl]phenyl] butanoate (PubChem CID 90710946) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is [4-[2-(difluoromethyl)-4-(6-methoxy-3-pyridinyl)-1,3-oxazol-5-yl]phenyl] butanoate.
| Compound Name | [4-[2-(difluoromethyl)-4-(6-methoxy-3-pyridinyl)-1,3-oxazol-5-yl]phenyl] butanoate |
|---|---|
| PubChem CID | 90710946 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [4-[2-(difluoromethyl)-4-(6-methoxy-3-pyridinyl)-1,3-oxazol-5-yl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(-c2oc(C(F)F)nc2-c2ccc(OC)nc2)cc1 |
| InChI | InChI=1S/C20H18F2N2O4/c1-3-4-16(25)27-14-8-5-12(6-9-14)18-17(24-20(28-18)19(21)22)13-7-10-15(26-2)23-11-13/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | AMNVCJUSCAXCJY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|