C42H64 — CID 90713565
3,6-ditert-butyl-9-[(4-tert-butyl-2-methylcyclopentyl)-naphthalen-1-ylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 90713565) has the molecular formula C42H64 and a molecular weight of 568.97 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[(4-tert-butyl-2-methylcyclopentyl)-naphthalen-1-ylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 3,6-ditert-butyl-9-[(4-tert-butyl-2-methylcyclopentyl)-naphthalen-1-ylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 90713565 |
| Molecular Formula | C42H64 |
| Molecular Weight | 568.97 g/mol |
| Exact Mass | 568.50 |
| IUPAC Name | 3,6-ditert-butyl-9-[(4-tert-butyl-2-methylcyclopentyl)-naphthalen-1-ylmethyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | CC1CC(C(C)(C)C)CC1C(c1cccc2ccccc12)C1C2CCC(C(C)(C)C)CC2C2CC(C(C)(C)C)CCC21 |
| InChI | InChI=1S/C42H64/c1-26-22-30(42(8,9)10)25-35(26)39(32-17-13-15-27-14-11-12-16-31(27)32)38-33-20-18-28(40(2,3)4)23-36(33)37-24-29(41(5,6)7)19-21-34(37)38/h11-17,26,28-30,33-39H,18-25H2,1-10H3 |
| InChIKey | XLMVXWORNZFYMY-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.97 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |