About [acetyl(ethyl)amino] methylsulfanylformate
[acetyl(ethyl)amino] methylsulfanylformate (PubChem CID 90714758) has the molecular formula C6H11NO3S
and a molecular weight of 177.22 g/mol. Its IUPAC name is [acetyl(ethyl)amino] methylsulfanylformate.
Molecular Properties
| Compound Name | [acetyl(ethyl)amino] methylsulfanylformate |
| PubChem CID | 90714758 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | [acetyl(ethyl)amino] methylsulfanylformate |
| SMILES | CCN(OC(=O)SC)C(C)=O |
| InChI | InChI=1S/C6H11NO3S/c1-4-7(5(2)8)10-6(9)11-3/h4H2,1-3H3 |
| InChIKey | KPJVSHLUDDGBJR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [acetyl(ethyl)amino] methylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyl(ethyl)amino] methylsulfanylformate?
The IUPAC name of [acetyl(ethyl)amino] methylsulfanylformate (CID 90714758) is [acetyl(ethyl)amino] methylsulfanylformate.
What is the SMILES notation for [acetyl(ethyl)amino] methylsulfanylformate?
The canonical SMILES for [acetyl(ethyl)amino] methylsulfanylformate is CCN(OC(=O)SC)C(C)=O.
What is the InChIKey of [acetyl(ethyl)amino] methylsulfanylformate?
The InChIKey is KPJVSHLUDDGBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3S/c1-4-7(5(2)8)10-6(9)11-3/h4H2,1-3H3.
What are the key properties of [acetyl(ethyl)amino] methylsulfanylformate?
[acetyl(ethyl)amino] methylsulfanylformate has a molecular weight of 177.22 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyl(ethyl)amino] methylsulfanylformate is sourced from PubChem (CID 90714758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).