C11H15BO4 — CID 90717019
CID 90717019 (PubChem CID 90717019) has the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol.
| Compound Name | CID 90717019 |
|---|---|
| PubChem CID | 90717019 |
| Molecular Formula | C11H15BO4 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | — |
| SMILES | [B]C1OC(COC(=C)C)C(O)C1OCC#C |
| InChI | InChI=1S/C11H15BO4/c1-4-5-14-10-9(13)8(16-11(10)12)6-15-7(2)3/h1,8-11,13H,2,5-6H2,3H3 |
| InChIKey | BREYRGUJBISVEC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|