About 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene
10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene (PubChem CID 90717187) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene.
Analyze 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene?
The IUPAC name of 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene (CID 90717187) is 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene.
What is the SMILES notation for 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene?
The canonical SMILES for 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene is CC1=CC2=CC=C3CCC3=C1C2.
What is the InChIKey of 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene?
The InChIKey is FQUJRDRNNFWGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12/c1-8-6-9-2-3-10-4-5-11(10)12(8)7-9/h2-3,6H,4-5,7H2,1H3.
What are the key properties of 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene?
10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene has a molecular weight of 156.23 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyltricyclo[6.2.1.02,5]undeca-1,5,7,9-tetraene is sourced from PubChem (CID 90717187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).