C18H16O4 — CID 141018935
(3Z,7Z,9E)-tricyclo[8.2.2.24,7]hexadeca-1,3,5,7,9,11-hexaene-5,12-dicarboxylic acid (PubChem CID 141018935) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3Z,7Z,9E)-tricyclo[8.2.2.24,7]hexadeca-1,3,5,7,9,11-hexaene-5,12-dicarboxylic acid.
| Compound Name | (3Z,7Z,9E)-tricyclo[8.2.2.24,7]hexadeca-1,3,5,7,9,11-hexaene-5,12-dicarboxylic acid |
|---|---|
| PubChem CID | 141018935 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (3Z,7Z,9E)-tricyclo[8.2.2.24,7]hexadeca-1,3,5,7,9,11-hexaene-5,12-dicarboxylic acid |
| SMILES | O=C(O)C1=C/C2=C/C=C3\C=C(C(=O)O)/C(=C\C=C1CC2)CC3 |
| InChI | InChI=1S/C18H16O4/c19-17(20)15-9-11-1-2-12-4-6-14(16(10-12)18(21)22)8-7-13(15)5-3-11/h1-2,7-10H,3-6H2,(H,19,20)(H,21,22)/b2-1-,8-7?,11-1-,12-2+,13-7-,14-8? |
| InChIKey | LOJZYOZFSKGANG-MPDAAKRMSA-N |
| XLogP | 3.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |