C34H30F3N3O3S — CID 90722659
8-benzyl-4-(2,4-difluorophenyl)imino-1-[5-fluoro-2-(4-methylsulfonylphenyl)phenyl]-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 90722659) has the molecular formula C34H30F3N3O3S and a molecular weight of 617.69 g/mol. Its IUPAC name is 8-benzyl-4-(2,4-difluorophenyl)imino-1-[5-fluoro-2-(4-methylsulfonylphenyl)phenyl]-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-benzyl-4-(2,4-difluorophenyl)imino-1-[5-fluoro-2-(4-methylsulfonylphenyl)phenyl]-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 90722659 |
| Molecular Formula | C34H30F3N3O3S |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 8-benzyl-4-(2,4-difluorophenyl)imino-1-[5-fluoro-2-(4-methylsulfonylphenyl)phenyl]-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(F)cc2N2C(=O)C/C(=N\c3ccc(F)cc3F)C23CCN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C34H30F3N3O3S/c1-44(42,43)27-11-7-24(8-12-27)28-13-9-26(36)20-31(28)40-33(41)21-32(38-30-14-10-25(35)19-29(30)37)34(40)15-17-39(18-16-34)22-23-5-3-2-4-6-23/h2-14,19-20H,15-18,21-22H2,1H3/b38-32+ |
| InChIKey | PBWZNRWULRKMMD-WAQNPYFYSA-N |
| XLogP | 6.72 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|