C26H41N5O4S — CID 90722784
tert-butyl 5-[imidazol-1-yl(propyl)carbamoyl]-4-methyl-2-(octylcarbamoylamino)thiophene-3-carboxylate (PubChem CID 90722784) has the molecular formula C26H41N5O4S and a molecular weight of 519.71 g/mol. Its IUPAC name is tert-butyl 5-[imidazol-1-yl(propyl)carbamoyl]-4-methyl-2-(octylcarbamoylamino)thiophene-3-carboxylate.
| Compound Name | tert-butyl 5-[imidazol-1-yl(propyl)carbamoyl]-4-methyl-2-(octylcarbamoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 90722784 |
| Molecular Formula | C26H41N5O4S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | tert-butyl 5-[imidazol-1-yl(propyl)carbamoyl]-4-methyl-2-(octylcarbamoylamino)thiophene-3-carboxylate |
| SMILES | CCCCCCCCNC(=O)Nc1sc(C(=O)N(CCC)n2ccnc2)c(C)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41N5O4S/c1-7-9-10-11-12-13-14-28-25(34)29-22-20(24(33)35-26(4,5)6)19(3)21(36-22)23(32)31(16-8-2)30-17-15-27-18-30/h15,17-18H,7-14,16H2,1-6H3,(H2,28,29,34) |
| InChIKey | CPUZHHRMHJLLKV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|