C22H29N3O7 — CID 90724594
6-(2,5-dihydroxypyrrol-1-yl)-6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoic acid (PubChem CID 90724594) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is 6-(2,5-dihydroxypyrrol-1-yl)-6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoic acid.
| Compound Name | 6-(2,5-dihydroxypyrrol-1-yl)-6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 90724594 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 6-(2,5-dihydroxypyrrol-1-yl)-6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCC(NC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)n1c(O)ccc1O |
| InChI | InChI=1S/C22H29N3O7/c26-17-9-10-18(27)24(17)13-14-5-7-15(8-6-14)22(32)23-16(3-1-2-4-21(30)31)25-19(28)11-12-20(25)29/h9-12,14-16,28-29H,1-8,13H2,(H,23,32)(H,30,31) |
| InChIKey | ZOBZCFODHLZBLE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|