C11H16N2 — CID 90724743
2,3,3a,4,6,9,9a,9b-octahydro-1H-pyrrolo[3,4-c]quinoline (PubChem CID 90724743) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3,3a,4,6,9,9a,9b-octahydro-1H-pyrrolo[3,4-c]quinoline.
| Compound Name | 2,3,3a,4,6,9,9a,9b-octahydro-1H-pyrrolo[3,4-c]quinoline |
|---|---|
| PubChem CID | 90724743 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3,3a,4,6,9,9a,9b-octahydro-1H-pyrrolo[3,4-c]quinoline |
| SMILES | C1=CCC2C(=NCC3CNCC32)C1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-11-9(3-1)10-7-12-5-8(10)6-13-11/h1-2,8-10,12H,3-7H2 |
| InChIKey | HJEMASMVEDNZCS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|