C27H36N7O+ — CID 90726289
[2-methyl-4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[2-(aminomethyl)-4-(2-methylpropyl)phenyl]-4-methylpyrazin-4-ium-2-carboximidate (PubChem CID 90726289) has the molecular formula C27H36N7O+ and a molecular weight of 474.63 g/mol. Its IUPAC name is [2-methyl-4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[2-(aminomethyl)-4-(2-methylpropyl)phenyl]-4-methylpyrazin-4-ium-2-carboximidate.
| Compound Name | [2-methyl-4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[2-(aminomethyl)-4-(2-methylpropyl)phenyl]-4-methylpyrazin-4-ium-2-carboximidate |
|---|---|
| PubChem CID | 90726289 |
| Molecular Formula | C27H36N7O+ |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [2-methyl-4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[2-(aminomethyl)-4-(2-methylpropyl)phenyl]-4-methylpyrazin-4-ium-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(CNC)cc1C)c1nc(-c2ccc(CC(C)C)cc2CN)c[n+](C)c1N |
| InChI | InChI=1S/C27H35N7O/c1-16(2)10-18-6-9-22(20(12-18)13-28)23-15-34(5)25(29)24(33-23)27(31)35-26(30)21-8-7-19(14-32-4)11-17(21)3/h6-9,11-12,15-16,29-32H,10,13-14,28H2,1-5H3/p+1/b30-26+,31-27- |
| InChIKey | NYIGEQFPODCOEU-FDMCKTFZSA-O |
| XLogP | 3.21 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|