C34H45N3O7S — CID 90727870
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-(18-methoxy-15-oxa-2-thia-3,9-diazatricyclo[14.4.0.05,9]icosa-1(16),11,17,19-tetraen-3-yl)-1-phenylbutan-2-yl]carbamate (PubChem CID 90727870) has the molecular formula C34H45N3O7S and a molecular weight of 639.82 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-(18-methoxy-15-oxa-2-thia-3,9-diazatricyclo[14.4.0.05,9]icosa-1(16),11,17,19-tetraen-3-yl)-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-(18-methoxy-15-oxa-2-thia-3,9-diazatricyclo[14.4.0.05,9]icosa-1(16),11,17,19-tetraen-3-yl)-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90727870 |
| Molecular Formula | C34H45N3O7S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-(18-methoxy-15-oxa-2-thia-3,9-diazatricyclo[14.4.0.05,9]icosa-1(16),11,17,19-tetraen-3-yl)-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc2c(c1)OCCC=CCN1CCCC1CN(CC(O)C(Cc1ccccc1)NC(=O)OC1COC3OCCC13)S2 |
| InChI | InChI=1S/C34H45N3O7S/c1-40-26-12-13-32-30(20-26)41-17-7-3-6-15-36-16-8-11-25(36)21-37(45-32)22-29(38)28(19-24-9-4-2-5-10-24)35-34(39)44-31-23-43-33-27(31)14-18-42-33/h2-6,9-10,12-13,20,25,27-29,31,33,38H,7-8,11,14-19,21-23H2,1H3,(H,35,39) |
| InChIKey | BNALIIGZVOYNQD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|