C22H14N2O4S — CID 90729257
ethyl 3-(1,3-benzothiazol-2-yl)-6-(4-cyanophenyl)-2,4-dioxohex-5-ynoate (PubChem CID 90729257) has the molecular formula C22H14N2O4S and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 3-(1,3-benzothiazol-2-yl)-6-(4-cyanophenyl)-2,4-dioxohex-5-ynoate.
| Compound Name | ethyl 3-(1,3-benzothiazol-2-yl)-6-(4-cyanophenyl)-2,4-dioxohex-5-ynoate |
|---|---|
| PubChem CID | 90729257 |
| Molecular Formula | C22H14N2O4S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | ethyl 3-(1,3-benzothiazol-2-yl)-6-(4-cyanophenyl)-2,4-dioxohex-5-ynoate |
| SMILES | CCOC(=O)C(=O)C(C(=O)C#Cc1ccc(C#N)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H14N2O4S/c1-2-28-22(27)20(26)19(21-24-16-5-3-4-6-18(16)29-21)17(25)12-11-14-7-9-15(13-23)10-8-14/h3-10,19H,2H2,1H3 |
| InChIKey | BYQXEYBMDRRAQU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|