C16H17N5O3S — CID 10316412
ethyl (3E)-2-[1,3-benzothiazol-2-yl(cyano)methyl]-3-(carbamoylhydrazinylidene)butanoate (PubChem CID 10316412) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is ethyl (3E)-2-[1,3-benzothiazol-2-yl(cyano)methyl]-3-(carbamoylhydrazinylidene)butanoate.
| Compound Name | ethyl (3E)-2-[1,3-benzothiazol-2-yl(cyano)methyl]-3-(carbamoylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 10316412 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | ethyl (3E)-2-[1,3-benzothiazol-2-yl(cyano)methyl]-3-(carbamoylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)C(/C(C)=N/NC(N)=O)C(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H17N5O3S/c1-3-24-15(22)13(9(2)20-21-16(18)23)10(8-17)14-19-11-6-4-5-7-12(11)25-14/h4-7,10,13H,3H2,1-2H3,(H3,18,21,23)/b20-9+ |
| InChIKey | PRMOCYSRYCQBCB-AWQFTUOYSA-N |
| XLogP | 2.13 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|