C13H22N2O2S — CID 90731273
ethane;2-methylsulfonyl-1,3,4,5-tetrahydro-2-benzazepin-5-amine (PubChem CID 90731273) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is ethane;2-methylsulfonyl-1,3,4,5-tetrahydro-2-benzazepin-5-amine.
| Compound Name | ethane;2-methylsulfonyl-1,3,4,5-tetrahydro-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 90731273 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | ethane;2-methylsulfonyl-1,3,4,5-tetrahydro-2-benzazepin-5-amine |
| SMILES | CC.CS(=O)(=O)N1CCC(N)c2ccccc2C1 |
| InChI | InChI=1S/C11H16N2O2S.C2H6/c1-16(14,15)13-7-6-11(12)10-5-3-2-4-9(10)8-13;1-2/h2-5,11H,6-8,12H2,1H3;1-2H3 |
| InChIKey | SOBUSZNYDGQTGG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |