C29H39BBrN7O4 — CID 90731914
3-bromo-6-(4-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine;tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (PubChem CID 90731914) has the molecular formula C29H39BBrN7O4 and a molecular weight of 640.39 g/mol. Its IUPAC name is 3-bromo-6-(4-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine;tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate.
| Compound Name | 3-bromo-6-(4-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine;tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 90731914 |
| Molecular Formula | C29H39BBrN7O4 |
| Molecular Weight | 640.39 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | 3-bromo-6-(4-methylpiperazin-1-yl)imidazo[1,2-b]pyridazine;tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(B3OC(C)(C)C(C)(C)O3)ccc21.CN1CCN(c2ccc3ncc(Br)n3n2)CC1 |
| InChI | InChI=1S/C18H25BN2O4.C11H14BrN5/c1-16(2,3)23-15(22)21-14-9-8-13(10-12(14)11-20-21)19-24-17(4,5)18(6,7)25-19;1-15-4-6-16(7-5-15)11-3-2-10-13-8-9(12)17(10)14-11/h8-11H,1-7H3;2-3,8H,4-7H2,1H3 |
| InChIKey | JXLPDHAQWDTRKX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 99.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|