C15H22N2OP+ — CID 90732516
methyl-[[3-(methylcarbamoyl)-4-phenylpyrrolidin-1-yl]methyl]-methylidenephosphanium (PubChem CID 90732516) has the molecular formula C15H22N2OP+ and a molecular weight of 277.33 g/mol. Its IUPAC name is methyl-[[3-(methylcarbamoyl)-4-phenylpyrrolidin-1-yl]methyl]-methylidenephosphanium.
| Compound Name | methyl-[[3-(methylcarbamoyl)-4-phenylpyrrolidin-1-yl]methyl]-methylidenephosphanium |
|---|---|
| PubChem CID | 90732516 |
| Molecular Formula | C15H22N2OP+ |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | methyl-[[3-(methylcarbamoyl)-4-phenylpyrrolidin-1-yl]methyl]-methylidenephosphanium |
| SMILES | C=[P+](C)CN1CC(C(=O)NC)C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H21N2OP/c1-16-15(18)14-10-17(11-19(2)3)9-13(14)12-7-5-4-6-8-12/h4-8,13-14H,2,9-11H2,1,3H3/p+1 |
| InChIKey | KMMBVMUMZNKHLB-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|