C35H32N2O8 — CID 90735279
[(3R,4S,5R)-5-[1-cyano-2-(cyanomethoxy)ethenyl]-4-methyl-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 90735279) has the molecular formula C35H32N2O8 and a molecular weight of 608.65 g/mol. Its IUPAC name is [(3R,4S,5R)-5-[1-cyano-2-(cyanomethoxy)ethenyl]-4-methyl-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(3R,4S,5R)-5-[1-cyano-2-(cyanomethoxy)ethenyl]-4-methyl-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 90735279 |
| Molecular Formula | C35H32N2O8 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | [(3R,4S,5R)-5-[1-cyano-2-(cyanomethoxy)ethenyl]-4-methyl-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC2O[C@H](C(C#N)=COCC#N)[C@](C)(OC(=O)c3ccc(C)cc3)[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H32N2O8/c1-22-5-11-25(12-6-22)32(38)42-21-29-31(44-33(39)26-13-7-23(2)8-14-26)35(4,30(43-29)28(19-37)20-41-18-17-36)45-34(40)27-15-9-24(3)10-16-27/h5-16,20,29-31H,18,21H2,1-4H3/t29?,30-,31-,35+/m1/s1 |
| InChIKey | BDRBMWCKXJPPSV-DCTJOMKSSA-N |
| XLogP | 5.33 |
| TPSA | 144.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|