C21H18N2O — CID 9074423
(2Z)-2-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]hydrazinylidene]-1,2-diphenylethanone (PubChem CID 9074423) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is (2Z)-2-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]hydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2Z)-2-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]hydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 9074423 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2Z)-2-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]hydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(/C(=N\N=C1\C[C@@H]2C=CC[C@H]12)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O/c24-21(16-10-5-2-6-11-16)20(15-8-3-1-4-9-15)23-22-19-14-17-12-7-13-18(17)19/h1-12,17-18H,13-14H2/b22-19-,23-20-/t17-,18-/m0/s1 |
| InChIKey | AGXGEIAFIKDLMG-IYSKRXOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|