C19H34O4 — CID 90747330
(2-butan-2-yl-2-prop-1-enyl-1,3-dioxolan-4-yl)methyl octanoate (PubChem CID 90747330) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2-butan-2-yl-2-prop-1-enyl-1,3-dioxolan-4-yl)methyl octanoate.
| Compound Name | (2-butan-2-yl-2-prop-1-enyl-1,3-dioxolan-4-yl)methyl octanoate |
|---|---|
| PubChem CID | 90747330 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2-butan-2-yl-2-prop-1-enyl-1,3-dioxolan-4-yl)methyl octanoate |
| SMILES | CC=CC1(C(C)CC)OCC(COC(=O)CCCCCCC)O1 |
| InChI | InChI=1S/C19H34O4/c1-5-8-9-10-11-12-18(20)21-14-17-15-22-19(23-17,13-6-2)16(4)7-3/h6,13,16-17H,5,7-12,14-15H2,1-4H3 |
| InChIKey | GHGWFEORWBDUSC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|