C11H21Br2NO — CID 90758931
3,5-dibromo-2-butylheptanamide (PubChem CID 90758931) has the molecular formula C11H21Br2NO and a molecular weight of 343.10 g/mol. Its IUPAC name is 3,5-dibromo-2-butylheptanamide.
| Compound Name | 3,5-dibromo-2-butylheptanamide |
|---|---|
| PubChem CID | 90758931 |
| Molecular Formula | C11H21Br2NO |
| Molecular Weight | 343.10 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3,5-dibromo-2-butylheptanamide |
| SMILES | CCCCC(C(N)=O)C(Br)CC(Br)CC |
| InChI | InChI=1S/C11H21Br2NO/c1-3-5-6-9(11(14)15)10(13)7-8(12)4-2/h8-10H,3-7H2,1-2H3,(H2,14,15) |
| InChIKey | JBJGLMPKYYFKQY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|