C9H7F6- — CID 90772961
5-methylidene-1,3-bis(trifluoromethyl)cyclohexene (PubChem CID 90772961) has the molecular formula C9H7F6- and a molecular weight of 229.14 g/mol. Its IUPAC name is 5-methylidene-1,3-bis(trifluoromethyl)cyclohexene.
| Compound Name | 5-methylidene-1,3-bis(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 90772961 |
| Molecular Formula | C9H7F6- |
| Molecular Weight | 229.14 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 5-methylidene-1,3-bis(trifluoromethyl)cyclohexene |
| SMILES | C=C1[CH-]C(C(F)(F)F)=CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H7F6/c1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15/h2,4,7H,1,3H2/q-1 |
| InChIKey | IMLISWSYAOXKQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|