C7H7NO4 — CID 90773699
2-(2,5-dihydroxypyrrol-1-yl)prop-2-enoic acid (PubChem CID 90773699) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)prop-2-enoic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 90773699 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C7H7NO4/c1-4(7(11)12)8-5(9)2-3-6(8)10/h2-3,9-10H,1H2,(H,11,12) |
| InChIKey | MQMPUWCBEIDMMY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|