C15H10ClFN2O4S2 — CID 90776216
[(1-carbamoyl-6-chloro-5-fluoro-2-hydroxyindol-3-yl)-thiophen-2-ylmethoxy]methanethioic S-acid (PubChem CID 90776216) has the molecular formula C15H10ClFN2O4S2 and a molecular weight of 400.84 g/mol. Its IUPAC name is [(1-carbamoyl-6-chloro-5-fluoro-2-hydroxyindol-3-yl)-thiophen-2-ylmethoxy]methanethioic S-acid.
| Compound Name | [(1-carbamoyl-6-chloro-5-fluoro-2-hydroxyindol-3-yl)-thiophen-2-ylmethoxy]methanethioic S-acid |
|---|---|
| PubChem CID | 90776216 |
| Molecular Formula | C15H10ClFN2O4S2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | [(1-carbamoyl-6-chloro-5-fluoro-2-hydroxyindol-3-yl)-thiophen-2-ylmethoxy]methanethioic S-acid |
| SMILES | NC(=O)n1c(O)c(C(OC(=O)S)c2cccs2)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C15H10ClFN2O4S2/c16-7-5-9-6(4-8(7)17)11(13(20)19(9)14(18)21)12(23-15(22)24)10-2-1-3-25-10/h1-5,12,20H,(H2,18,21)(H,22,24) |
| InChIKey | ZTRUASLAEKLOMC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|