C21H19ClFN3O7S — CID 19735950
1-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]ethyl [2-(dimethylamino)-2-oxoethyl] carbonate (PubChem CID 19735950) has the molecular formula C21H19ClFN3O7S and a molecular weight of 511.92 g/mol. Its IUPAC name is 1-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]ethyl [2-(dimethylamino)-2-oxoethyl] carbonate.
| Compound Name | 1-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]ethyl [2-(dimethylamino)-2-oxoethyl] carbonate |
|---|---|
| PubChem CID | 19735950 |
| Molecular Formula | C21H19ClFN3O7S |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 1-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]ethyl [2-(dimethylamino)-2-oxoethyl] carbonate |
| SMILES | CC(OC(=O)OCC(=O)N(C)C)O/C(=C1\C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C21H19ClFN3O7S/c1-10(33-21(30)31-9-16(27)25(2)3)32-18(15-5-4-6-34-15)17-11-7-13(23)12(22)8-14(11)26(19(17)28)20(24)29/h4-8,10H,9H2,1-3H3,(H2,24,29)/b18-17- |
| InChIKey | NHUAKHWURCAMHD-ZCXUNETKSA-N |
| XLogP | 3.44 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|