C26H26ClFN2O6S — CID 67691664
4-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-octyl (E)-but-2-enedioate (PubChem CID 67691664) has the molecular formula C26H26ClFN2O6S and a molecular weight of 549.02 g/mol. Its IUPAC name is 4-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-octyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-octyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 67691664 |
| Molecular Formula | C26H26ClFN2O6S |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 4-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-octyl (E)-but-2-enedioate |
| SMILES | CCCCCCCCOC(=O)/C=C/C(=O)O/C(=C1/C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C26H26ClFN2O6S/c1-2-3-4-5-6-7-12-35-21(31)10-11-22(32)36-24(20-9-8-13-37-20)23-16-14-18(28)17(27)15-19(16)30(25(23)33)26(29)34/h8-11,13-15H,2-7,12H2,1H3,(H2,29,34)/b11-10+,24-23+ |
| InChIKey | PQPQJJJJYHISFJ-MCRSFOJQSA-N |
| XLogP | 5.84 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|