C26H20ClFN2O8S — CID 67691366
benzyl 2-[2-[[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methoxy]-2-oxoethoxy]acetate (PubChem CID 67691366) has the molecular formula C26H20ClFN2O8S and a molecular weight of 574.97 g/mol. Its IUPAC name is benzyl 2-[2-[[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methoxy]-2-oxoethoxy]acetate.
| Compound Name | benzyl 2-[2-[[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methoxy]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 67691366 |
| Molecular Formula | C26H20ClFN2O8S |
| Molecular Weight | 574.97 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | benzyl 2-[2-[[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methoxy]-2-oxoethoxy]acetate |
| SMILES | NC(=O)N1C(=O)C(=C(OCOC(=O)COCC(=O)OCc2ccccc2)c2cccs2)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C26H20ClFN2O8S/c27-17-10-19-16(9-18(17)28)23(25(33)30(19)26(29)34)24(20-7-4-8-39-20)38-14-37-22(32)13-35-12-21(31)36-11-15-5-2-1-3-6-15/h1-10H,11-14H2,(H2,29,34) |
| InChIKey | POVIQJATLJSGRS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|