C18H12ClFN2O6S — CID 10717892
[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 2-acetyloxyacetate (PubChem CID 10717892) has the molecular formula C18H12ClFN2O6S and a molecular weight of 438.82 g/mol. Its IUPAC name is [(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 2-acetyloxyacetate.
| Compound Name | [(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 2-acetyloxyacetate |
|---|---|
| PubChem CID | 10717892 |
| Molecular Formula | C18H12ClFN2O6S |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | [(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 2-acetyloxyacetate |
| SMILES | CC(=O)OCC(=O)O/C(=C1\C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C18H12ClFN2O6S/c1-8(23)27-7-14(24)28-16(13-3-2-4-29-13)15-9-5-11(20)10(19)6-12(9)22(17(15)25)18(21)26/h2-6H,7H2,1H3,(H2,21,26)/b16-15- |
| InChIKey | OPJLPCPGLZUFEG-NXVVXOECSA-N |
| XLogP | 2.94 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|