C22H21ClFN3O7S — CID 10720880
[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 10720880) has the molecular formula C22H21ClFN3O7S and a molecular weight of 525.94 g/mol. Its IUPAC name is [(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 10720880 |
| Molecular Formula | C22H21ClFN3O7S |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | [(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)OCO/C(=C1/C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C22H21ClFN3O7S/c1-22(2,3)34-21(31)26-9-16(28)32-10-33-18(15-5-4-6-35-15)17-11-7-13(24)12(23)8-14(11)27(19(17)29)20(25)30/h4-8H,9-10H2,1-3H3,(H2,25,30)(H,26,31)/b18-17+ |
| InChIKey | NAHDXZBSUCFHKN-ISLYRVAYSA-N |
| XLogP | 3.88 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|