C23H22ClFN2O6SSi — CID 10530432
4-O-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2-trimethylsilylethyl) (E)-but-2-enedioate (PubChem CID 10530432) has the molecular formula C23H22ClFN2O6SSi and a molecular weight of 537.04 g/mol. Its IUPAC name is 4-O-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2-trimethylsilylethyl) (E)-but-2-enedioate.
| Compound Name | 4-O-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2-trimethylsilylethyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 10530432 |
| Molecular Formula | C23H22ClFN2O6SSi |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 4-O-[(Z)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2-trimethylsilylethyl) (E)-but-2-enedioate |
| SMILES | C[Si](C)(C)CCOC(=O)/C=C/C(=O)O/C(=C1\C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C23H22ClFN2O6SSi/c1-35(2,3)10-8-32-18(28)6-7-19(29)33-21(17-5-4-9-34-17)20-13-11-15(25)14(24)12-16(13)27(22(20)30)23(26)31/h4-7,9,11-12H,8,10H2,1-3H3,(H2,26,31)/b7-6+,21-20- |
| InChIKey | PIQHJMKOQJDADN-SPPJIQIJSA-N |
| XLogP | 4.82 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|