C22H18ClFN2O6S — CID 139754391
1-O-butan-2-yl 4-O-[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] but-2-enedioate (PubChem CID 139754391) has the molecular formula C22H18ClFN2O6S and a molecular weight of 492.91 g/mol. Its IUPAC name is 1-O-butan-2-yl 4-O-[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] but-2-enedioate.
| Compound Name | 1-O-butan-2-yl 4-O-[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] but-2-enedioate |
|---|---|
| PubChem CID | 139754391 |
| Molecular Formula | C22H18ClFN2O6S |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 1-O-butan-2-yl 4-O-[(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] but-2-enedioate |
| SMILES | CCC(C)OC(=O)C=CC(=O)OC(=C1C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C22H18ClFN2O6S/c1-3-11(2)31-17(27)6-7-18(28)32-20(16-5-4-8-33-16)19-12-9-14(24)13(23)10-15(12)26(21(19)29)22(25)30/h4-11H,3H2,1-2H3,(H2,25,30) |
| InChIKey | MPACSYXLCLMUKX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|