C16H16O4 — CID 90776819
4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-2-en-1-one (PubChem CID 90776819) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-2-en-1-one.
| Compound Name | 4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 90776819 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)C2C=CC(=O)CC2)ccc1O |
| InChI | InChI=1S/C16H16O4/c1-20-16-10-11(3-9-15(16)19)2-8-14(18)12-4-6-13(17)7-5-12/h2-4,6,8-10,12,19H,5,7H2,1H3 |
| InChIKey | IBWYGISNWKRJEH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|