About CID 90784675
CID 90784675 (PubChem CID 90784675) has the molecular formula C5H9B
and a molecular weight of 79.94 g/mol.
Molecular Properties
| Compound Name | CID 90784675 |
| PubChem CID | 90784675 |
| Molecular Formula | C5H9B |
| Molecular Weight | 79.94 g/mol |
| Exact Mass | 80.08 |
| IUPAC Name | — |
| SMILES | [B]CC(C)=CC |
| InChI | InChI=1S/C5H9B/c1-3-5(2)4-6/h3H,4H2,1-2H3 |
| InChIKey | QYBURFQWKQMKSG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 79.94 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 90784675 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90784675?
The IUPAC name of CID 90784675 (CID 90784675) is not available.
What is the SMILES notation for CID 90784675?
The canonical SMILES for CID 90784675 is [B]CC(C)=CC.
What is the InChIKey of CID 90784675?
The InChIKey is QYBURFQWKQMKSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9B/c1-3-5(2)4-6/h3H,4H2,1-2H3.
What are the key properties of CID 90784675?
CID 90784675 has a molecular weight of 79.94 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90784675 is sourced from PubChem (CID 90784675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).