C23H37BrN2O2 — CID 90786799
tert-butyl N-[2-[6-bromohexyl-[(2-cyclopropylphenyl)methyl]amino]ethyl]carbamate (PubChem CID 90786799) has the molecular formula C23H37BrN2O2 and a molecular weight of 453.47 g/mol. Its IUPAC name is tert-butyl N-[2-[6-bromohexyl-[(2-cyclopropylphenyl)methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-bromohexyl-[(2-cyclopropylphenyl)methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 90786799 |
| Molecular Formula | C23H37BrN2O2 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | tert-butyl N-[2-[6-bromohexyl-[(2-cyclopropylphenyl)methyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(CCCCCCBr)Cc1ccccc1C1CC1 |
| InChI | InChI=1S/C23H37BrN2O2/c1-23(2,3)28-22(27)25-15-17-26(16-9-5-4-8-14-24)18-20-10-6-7-11-21(20)19-12-13-19/h6-7,10-11,19H,4-5,8-9,12-18H2,1-3H3,(H,25,27) |
| InChIKey | DRHBHPKZEWPEAJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|