C36H44O8 — CID 90788540
(6S,7S)-7-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2,5-dimethyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 90788540) has the molecular formula C36H44O8 and a molecular weight of 604.74 g/mol. Its IUPAC name is (6S,7S)-7-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2,5-dimethyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (6S,7S)-7-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2,5-dimethyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 90788540 |
| Molecular Formula | C36H44O8 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | (6S,7S)-7-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2,5-dimethyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | CC1OC2OC(C)[C@H](OCc3ccccc3)[C@H](O[C@@H]3OC(C)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3C)C2O1 |
| InChI | InChI=1S/C36H44O8/c1-23-30(37-20-27-14-8-5-9-15-27)31(38-21-28-16-10-6-11-17-28)24(2)40-35(23)44-33-32(39-22-29-18-12-7-13-19-29)25(3)41-36-34(33)42-26(4)43-36/h5-19,23-26,30-36H,20-22H2,1-4H3/t23?,24?,25?,26?,30-,31+,32+,33+,34?,35+,36?/m1/s1 |
| InChIKey | QACYDJUUTBLNIW-FXZBBMNASA-N |
| XLogP | 6.01 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |