C27H56N4O2 — CID 90791613
3-[2-[methyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide (PubChem CID 90791613) has the molecular formula C27H56N4O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is 3-[2-[methyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide.
| Compound Name | 3-[2-[methyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
|---|---|
| PubChem CID | 90791613 |
| Molecular Formula | C27H56N4O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.44 |
| IUPAC Name | 3-[2-[methyl-[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]ethylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
| SMILES | CN(CCNCCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H56N4O2/c1-24(2,3)18-26(7,8)20-29-22(32)12-14-28-15-17-31(11)16-13-23(33)30-21-27(9,10)19-25(4,5)6/h28H,12-21H2,1-11H3,(H,29,32)(H,30,33) |
| InChIKey | HMFDALGYRYEXMG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|