C19H41N3O3 — CID 90920758
3-[2-hydroxyethyl-[2-(2-hydroxyethylamino)ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide (PubChem CID 90920758) has the molecular formula C19H41N3O3 and a molecular weight of 359.56 g/mol. Its IUPAC name is 3-[2-hydroxyethyl-[2-(2-hydroxyethylamino)ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide.
| Compound Name | 3-[2-hydroxyethyl-[2-(2-hydroxyethylamino)ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
|---|---|
| PubChem CID | 90920758 |
| Molecular Formula | C19H41N3O3 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.31 |
| IUPAC Name | 3-[2-hydroxyethyl-[2-(2-hydroxyethylamino)ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
| SMILES | CCC(C)(C)CC(C)(C)CNC(=O)CCN(CCO)CCNCCO |
| InChI | InChI=1S/C19H41N3O3/c1-6-18(2,3)15-19(4,5)16-21-17(25)7-10-22(12-14-24)11-8-20-9-13-23/h20,23-24H,6-16H2,1-5H3,(H,21,25) |
| InChIKey | FFOXZPLRLJQBLL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|