C29H60N4O3 — CID 90867767
3-[2-(2-hydroxyethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylpentyl)propanamide (PubChem CID 90867767) has the molecular formula C29H60N4O3 and a molecular weight of 512.82 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylpentyl)propanamide.
| Compound Name | 3-[2-(2-hydroxyethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
|---|---|
| PubChem CID | 90867767 |
| Molecular Formula | C29H60N4O3 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.47 |
| IUPAC Name | 3-[2-(2-hydroxyethylamino)ethyl-[3-oxo-3-(2,2,4,4-tetramethylhexylamino)propyl]amino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
| SMILES | CCC(C)(C)CC(C)(C)CNC(=O)CCN(CCNCCO)CCC(=O)NCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C29H60N4O3/c1-11-27(5,6)21-29(9,10)23-32-25(36)13-17-33(18-14-30-15-19-34)16-12-24(35)31-22-28(7,8)20-26(2,3)4/h30,34H,11-23H2,1-10H3,(H,31,35)(H,32,36) |
| InChIKey | IMRDMHGSRLEWAW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|