C12H28N4O3 — CID 143379071
3-[2-(2-hydroxyethylamino)ethyl-[3-hydroxy-3-(methylamino)propyl]amino]-N-methylpropanamide (PubChem CID 143379071) has the molecular formula C12H28N4O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethylamino)ethyl-[3-hydroxy-3-(methylamino)propyl]amino]-N-methylpropanamide.
| Compound Name | 3-[2-(2-hydroxyethylamino)ethyl-[3-hydroxy-3-(methylamino)propyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 143379071 |
| Molecular Formula | C12H28N4O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3-[2-(2-hydroxyethylamino)ethyl-[3-hydroxy-3-(methylamino)propyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(CCNCCO)CCC(O)NC |
| InChI | InChI=1S/C12H28N4O3/c1-13-11(18)3-7-16(8-4-12(19)14-2)9-5-15-6-10-17/h11,13,15,17-18H,3-10H2,1-2H3,(H,14,19) |
| InChIKey | MEPYGAPROIXKSW-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|