C17H19NO4 — CID 90792346
(5R)-5-(2-phenylethyl)-3-[(2S)-pyrrolidine-2-carbonyl]oxolane-2,4-dione (PubChem CID 90792346) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (5R)-5-(2-phenylethyl)-3-[(2S)-pyrrolidine-2-carbonyl]oxolane-2,4-dione.
| Compound Name | (5R)-5-(2-phenylethyl)-3-[(2S)-pyrrolidine-2-carbonyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 90792346 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (5R)-5-(2-phenylethyl)-3-[(2S)-pyrrolidine-2-carbonyl]oxolane-2,4-dione |
| SMILES | O=C1O[C@H](CCc2ccccc2)C(=O)C1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H19NO4/c19-15(12-7-4-10-18-12)14-16(20)13(22-17(14)21)9-8-11-5-2-1-3-6-11/h1-3,5-6,12-14,18H,4,7-10H2/t12-,13+,14?/m0/s1 |
| InChIKey | RSSJVYLOUIRMEJ-WLDKUNSKSA-N |
| XLogP | 1.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|