C12H24O2 — CID 90793138
ethane;trans-(1R,2S)-2-(3-hydroxyprop-1-en-2-yl)cycloheptan-1-ol (PubChem CID 90793138) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is ethane;trans-(1R,2S)-2-(3-hydroxyprop-1-en-2-yl)cycloheptan-1-ol.
| Compound Name | ethane;trans-(1R,2S)-2-(3-hydroxyprop-1-en-2-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 90793138 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | ethane;trans-(1R,2S)-2-(3-hydroxyprop-1-en-2-yl)cycloheptan-1-ol |
| SMILES | C=C(CO)[C@@H]1CCCCC[C@H]1O.CC |
| InChI | InChI=1S/C10H18O2.C2H6/c1-8(7-11)9-5-3-2-4-6-10(9)12;1-2/h9-12H,1-7H2;1-2H3/t9-,10+;/m0./s1 |
| InChIKey | OBNDLOMJGKQIBA-BAUSSPIASA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|