C20H26O7S — CID 90793570
3-octoxycarbonyl-5-phenyl-4-sulfopenta-2,4-dienoic acid (PubChem CID 90793570) has the molecular formula C20H26O7S and a molecular weight of 410.49 g/mol. Its IUPAC name is 3-octoxycarbonyl-5-phenyl-4-sulfopenta-2,4-dienoic acid.
| Compound Name | 3-octoxycarbonyl-5-phenyl-4-sulfopenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90793570 |
| Molecular Formula | C20H26O7S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-octoxycarbonyl-5-phenyl-4-sulfopenta-2,4-dienoic acid |
| SMILES | CCCCCCCCOC(=O)C(=CC(=O)O)C(=Cc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C20H26O7S/c1-2-3-4-5-6-10-13-27-20(23)17(15-19(21)22)18(28(24,25)26)14-16-11-8-7-9-12-16/h7-9,11-12,14-15H,2-6,10,13H2,1H3,(H,21,22)(H,24,25,26) |
| InChIKey | AZTXVMYWZLUNAK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|