C23H31N5O3 — CID 90800414
5,7,8-trimethyl-6-[(3,4,5-trimethoxy-2,6-dimethylanilino)methyl]quinazoline-2,4-diamine (PubChem CID 90800414) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 5,7,8-trimethyl-6-[(3,4,5-trimethoxy-2,6-dimethylanilino)methyl]quinazoline-2,4-diamine.
| Compound Name | 5,7,8-trimethyl-6-[(3,4,5-trimethoxy-2,6-dimethylanilino)methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 90800414 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 5,7,8-trimethyl-6-[(3,4,5-trimethoxy-2,6-dimethylanilino)methyl]quinazoline-2,4-diamine |
| SMILES | COc1c(C)c(NCc2c(C)c(C)c3nc(N)nc(N)c3c2C)c(C)c(OC)c1OC |
| InChI | InChI=1S/C23H31N5O3/c1-10-11(2)18-16(22(24)28-23(25)27-18)12(3)15(10)9-26-17-13(4)19(29-6)21(31-8)20(30-7)14(17)5/h26H,9H2,1-8H3,(H4,24,25,27,28) |
| InChIKey | ZFAMLKZBVQFQQJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|