C25H44O3 — CID 90800993
(5-ethyl-2,2,4,4,5,7,7,10-octamethyl-9-oxoundec-10-enyl) 2-methylprop-2-enoate (PubChem CID 90800993) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is (5-ethyl-2,2,4,4,5,7,7,10-octamethyl-9-oxoundec-10-enyl) 2-methylprop-2-enoate.
| Compound Name | (5-ethyl-2,2,4,4,5,7,7,10-octamethyl-9-oxoundec-10-enyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90800993 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | (5-ethyl-2,2,4,4,5,7,7,10-octamethyl-9-oxoundec-10-enyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)CC(C)(C)CC(C)(CC)C(C)(C)CC(C)(C)COC(=O)C(=C)C |
| InChI | InChI=1S/C25H44O3/c1-13-25(12,16-22(6,7)14-20(26)18(2)3)24(10,11)15-23(8,9)17-28-21(27)19(4)5/h2,4,13-17H2,1,3,5-12H3 |
| InChIKey | JHVAYYBIVXHYQG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|