C28H39N5O6S — CID 90802092
[(1S)-1-hydroxy-2-(pyridin-2-ylsulfonylamino)ethyl] N-[(2S)-1-(4-imidazol-1-ylphenoxy)-3,3-dimethylbutan-2-yl]-N-pentylcarbamate (PubChem CID 90802092) has the molecular formula C28H39N5O6S and a molecular weight of 573.72 g/mol. Its IUPAC name is [(1S)-1-hydroxy-2-(pyridin-2-ylsulfonylamino)ethyl] N-[(2S)-1-(4-imidazol-1-ylphenoxy)-3,3-dimethylbutan-2-yl]-N-pentylcarbamate.
| Compound Name | [(1S)-1-hydroxy-2-(pyridin-2-ylsulfonylamino)ethyl] N-[(2S)-1-(4-imidazol-1-ylphenoxy)-3,3-dimethylbutan-2-yl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 90802092 |
| Molecular Formula | C28H39N5O6S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | [(1S)-1-hydroxy-2-(pyridin-2-ylsulfonylamino)ethyl] N-[(2S)-1-(4-imidazol-1-ylphenoxy)-3,3-dimethylbutan-2-yl]-N-pentylcarbamate |
| SMILES | CCCCCN(C(=O)O[C@H](O)CNS(=O)(=O)c1ccccn1)[C@H](COc1ccc(-n2ccnc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H39N5O6S/c1-5-6-9-17-33(27(35)39-26(34)19-31-40(36,37)25-10-7-8-15-30-25)24(28(2,3)4)20-38-23-13-11-22(12-14-23)32-18-16-29-21-32/h7-8,10-16,18,21,24,26,31,34H,5-6,9,17,19-20H2,1-4H3/t24-,26+/m1/s1 |
| InChIKey | OHXJCMKDIOUETI-RSXGOPAZSA-N |
| XLogP | 3.99 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|