C15H33O+ — CID 90803998
3,5-diethylheptan-2-yl-methyl-propyloxidanium (PubChem CID 90803998) has the molecular formula C15H33O+ and a molecular weight of 229.43 g/mol. Its IUPAC name is 3,5-diethylheptan-2-yl-methyl-propyloxidanium.
| Compound Name | 3,5-diethylheptan-2-yl-methyl-propyloxidanium |
|---|---|
| PubChem CID | 90803998 |
| Molecular Formula | C15H33O+ |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | 3,5-diethylheptan-2-yl-methyl-propyloxidanium |
| SMILES | CCC[O+](C)C(C)C(CC)CC(CC)CC |
| InChI | InChI=1S/C15H33O/c1-7-11-16(6)13(5)15(10-4)12-14(8-2)9-3/h13-15H,7-12H2,1-6H3/q+1 |
| InChIKey | NAXKMXKNAMXCBH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|