C13H22N2O4 — CID 90814586
(2,5-dihydroxypyrrol-1-yl) N-heptyl-N-methylcarbamate (PubChem CID 90814586) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-heptyl-N-methylcarbamate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-heptyl-N-methylcarbamate |
|---|---|
| PubChem CID | 90814586 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-heptyl-N-methylcarbamate |
| SMILES | CCCCCCCN(C)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C13H22N2O4/c1-3-4-5-6-7-10-14(2)13(18)19-15-11(16)8-9-12(15)17/h8-9,16-17H,3-7,10H2,1-2H3 |
| InChIKey | VXJRVMSKCOJHHZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|